For research use only. Not for therapeutic Use.
Pancratistatin(CAT: I012309) is a natural alkaloid derived from Amaryllidaceae plants, known for its selective cytotoxicity against cancer cells. It induces apoptosis through mitochondrial pathways, bypassing the need for p53 activation, making it effective in targeting resistant cancer types. Its mechanism is particularly significant in the oncology field, where it offers potential as a novel anti-cancer agent with minimal effects on healthy cells. Pancratistatin is widely utilized in research to study apoptosis, cancer cell metabolism, and drug development, providing valuable insights into therapeutic strategies for various malignancies.
| Catalog Number | I012309 |
| CAS Number | 96281-31-1 |
| Synonyms | (1R,2S,3S,4S,4aR,11bR)-1,2,3,4,7-pentahydroxy-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo [4,5-j]phenanthridin-6-one |
| Molecular Formula | C14H15NO8 |
| Purity | ≥95% |
| IUPAC Name | (1R,2S,3S,4S,4aR)-1,2,3,4,7-pentahydroxy-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-6-one |
| InChI | InChI=1S/C14H15NO8/c16-8-5-3-1-4-13(23-2-22-4)9(17)6(3)14(21)15-7(5)10(18)12(20)11(8)19/h1,5,7-8,10-12,16-20H,2H2,(H,15,21)/t5?,7-,8-,10+,11+,12+/m1/s1 |
| InChIKey | VREZDOWOLGNDPW-VYLNOMTASA-N |
| SMILES | C1OC2=C(O1)C(=C3C(=C2)C4C(C(C(C(C4O)O)O)O)NC3=O)O |
