For research use only. Not for therapeutic Use.
Pancratistatin is a natural alkaloid extracted from plants of the Amaryllidaceae family. It exhibits potent anticancer properties, selectively targeting cancer cells while sparing normal cells. Research into pancratistatin focuses on its potential as a chemotherapeutic agent, exploring its mechanisms of action and efficacy against various cancer types. Its unique biological activity makes it a promising candidate for cancer treatment.
CAS Number | 96203-70-2 |
Synonyms | (1R,2S,3S,4S,4aR,11bR)-1,3,4,4a,5,11b-hexahydro-1,2,3,4,7-pentahydroxy-[1,3]Dioxolo[4,5-j]phenanthridin-6(2H)-one; [1R-(1α,2β,3α,4α,4aα,11bβ)]-1,3,4,4a,5,11b-hexahydro-1,2,3,4,7-pentahydroxy-[1,3]Dioxolo[4,5-j]phenanthridin-6(2H)-one; (+)-Pancratista |
Molecular Formula | C14H15NO8 |
Purity | ≥95% |
Target | Apoptosis |
Storage | -20°C |
IUPAC Name | (1R,2S,3S,4S,4aR,11bR)-1,2,3,4,7-pentahydroxy-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-6-one |
InChI | InChI=1S/C14H15NO8/c16-8-5-3-1-4-13(23-2-22-4)9(17)6(3)14(21)15-7(5)10(18)12(20)11(8)19/h1,5,7-8,10-12,16-20H,2H2,(H,15,21)/t5-,7-,8-,10+,11+,12+/m1/s1 |
InChIKey | VREZDOWOLGNDPW-ALTGWBOUSA-N |
SMILES | C1OC2=C(O1)C(=C3C(=C2)C4C(C(C(C(C4O)O)O)O)NC3=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |