For research use only. Not for therapeutic Use.
Panidazole（Cat No.:M055387）, is an antiprotozoal agent used in veterinary medicine. It is a nitroimidazole compound with antiprotozoal and antibacterial properties. Panidazole is primarily used to treat protozoal infections in animals, such as coccidiosis and trichomoniasis.
| Catalog Number | M055387 |
| CAS Number | 13752-33-5 |
| Molecular Formula | C11H12N4O2 |
| Purity | ≥95% |
| Storage | Store at -20C |
| IUPAC Name | 4-[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]pyridine |
| InChI | InChI=1S/C11H12N4O2/c1-9-13-8-11(15(16)17)14(9)7-4-10-2-5-12-6-3-10/h2-3,5-6,8H,4,7H2,1H3 |
| InChIKey | ARYPMCPJIWUCIP-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(N1CCC2=CC=NC=C2)[N+](=O)[O-] |
