For research use only. Not for therapeutic Use.
Panidazole（Cat No.:M055387）is a nitroimidazole derivative with antimicrobial properties, primarily used in the treatment of protozoal infections and anaerobic bacterial infections. It works by disrupting DNA synthesis in susceptible organisms, leading to their death. Panidazole is particularly effective against conditions caused by Entamoeba histolytica, Giardia lamblia, and Trichomonas vaginalis. Its mechanism of action and spectrum of activity are similar to other nitroimidazoles, making it valuable in managing infections in both humans and animals. Panidazole’s efficacy and safety profile make it a useful option in controlling anaerobic infections.
| Catalog Number | M055387 |
| CAS Number | 13752-33-5 |
| Molecular Formula | C11H12N4O2 |
| Purity | ≥95% |
| Target | Parasite |
| Storage | Store at -20C |
| IUPAC Name | 4-[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]pyridine |
| InChI | InChI=1S/C11H12N4O2/c1-9-13-8-11(15(16)17)14(9)7-4-10-2-5-12-6-3-10/h2-3,5-6,8H,4,7H2,1H3 |
| InChIKey | ARYPMCPJIWUCIP-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(N1CCC2=CC=NC=C2)[N+](=O)[O-] |
