For research use only. Not for therapeutic Use.
Pantethine (Cat No.: I002197) is a compound derived from pantothenic acid, and it can be seen as a stable disulfide polymer of pantethine. This compound is a vital component of the factor structure, with its naturally occurring form being the D(+) configuration. This particular configuration is considered a more effective form of vitamin B5. Pantethine plays a significant role in various metabolic processes and is valued for its potential health benefits, particularly in supporting energy metabolism and overall well-being.
CAS Number | 16816-67-4 |
Molecular Formula | C22H42N4O8S2 |
Purity | ≥95% |
Target | Anti-infection |
Solubility | DMSO: ≥ 30 mg/mL |
Storage | 2-8°C |
IUPAC Name | (2R)-N-[3-[2-[2-[3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyldisulfanyl]ethylamino]-3-oxopropyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
InChI | InChI=1S/C22H42N4O8S2/c1-21(2,13-27)17(31)19(33)25-7-5-15(29)23-9-11-35-36-12-10-24-16(30)6-8-26-20(34)18(32)22(3,4)14-28/h17-18,27-28,31-32H,5-14H2,1-4H3,(H,23,29)(H,24,30)(H,25,33)(H,26,34)/t17-,18-/m0/s1 |
InChIKey | DJWYOLJPSHDSAL-ROUUACIJSA-N |
SMILES | CC(C)(CO)C(C(=O)NCCC(=O)NCCSSCCNC(=O)CCNC(=O)C(C(C)(C)CO)O)O |
Reference | <p style=/line-height:25px/> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |