For research use only. Not for therapeutic Use.
PAP-1(CAT: I005241) is a potent and selective inhibitor of the Kv1.3 voltage-gated potassium channel, which plays a crucial role in regulating the membrane potential and calcium signaling in T cells. By targeting Kv1.3, PAP-1 suppresses T cell activation and proliferation, making it particularly valuable in immunology and autoimmune disease research. This compound has shown potential in studies on conditions such as multiple sclerosis, rheumatoid arthritis, and psoriasis, where aberrant T cell activity is implicated. PAP-1 is an essential tool for investigating Kv1.3 channel function and developing targeted immunomodulatory therapies.
CAS Number | 870653-45-5 |
Synonyms | 4-(4-phenoxybutoxy)furo[3,2-g]chromen-7-one |
Molecular Formula | C21H18O5 |
Purity | ≥95% |
Target | Potassium Channel |
Solubility | DMSO:9 mg/mL |
Storage | Store at -20°C |
IC50 | 2 nM (EC50) [1] |
IUPAC Name | 4-(4-phenoxybutoxy)furo[3,2-g]chromen-7-one |
InChI | InChI=1S/C21H18O5/c22-20-9-8-16-19(26-20)14-18-17(10-13-24-18)21(16)25-12-5-4-11-23-15-6-2-1-3-7-15/h1-3,6-10,13-14H,4-5,11-12H2 |
InChIKey | KINMYBBFQRSVLL-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)OCCCCOC2=C3C=CC(=O)OC3=CC4=C2C=CO4 |