For research use only. Not for therapeutic Use.
Paraffin wax (Cat.No:M025036) is a colorless, odorless solid derived from petroleum. It consists of a mixture of hydrocarbon molecules and is used in various applications, including candles, cosmetics, and as a coating for food preservation. Its low melting point makes it easy to work with in many industries.
| Catalog Number | M025036 |
| CAS Number | 8002-74-2 |
| Synonyms | TISSUEPREP 2 EMBEDDING MEDIA;PATHOPREP 546;PATHOPREP568;PATHOPREP580;paraffinwaxfume;waxes:paraffin;Paraffin waxes and Hydrocarbon waxes;SYNTHETIC WAX |
| Molecular Formula | C21H27NO3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-[2-[2-hydroxy-3-(propylamino)propoxy]phenyl]-3-phenylpropan-1-one |
| InChI | InChI=1S/C21H27NO3/c1-2-14-22-15-18(23)16-25-21-11-7-6-10-19(21)20(24)13-12-17-8-4-3-5-9-17/h3-11,18,22-23H,2,12-16H2,1H3 |
| InChIKey | JWHAUXFOSRPERK-UHFFFAOYSA-N |
| SMILES | CCCNCC(COC1=CC=CC=C1C(=O)CCC2=CC=CC=C2)O |
