For research use only. Not for therapeutic Use.
Paraquat (Cat.No:M349249) is a widely used herbicide known for its high toxicity. It works by disrupting photosynthesis in plants. However, it’s extremely dangerous to humans and animals, causing severe toxicity if ingested or inhaled.
Catalog Number | M349249 |
CAS Number | 4685-14-7 |
Molecular Formula | C12H14N2+2 |
Purity | ≥95% |
IUPAC Name | 1-methyl-4-(1-methylpyridin-1-ium-4-yl)pyridin-1-ium |
InChI | InChI=1S/C12H14N2/c1-13-7-3-11(4-8-13)12-5-9-14(2)10-6-12/h3-10H,1-2H3/q+2 |
InChIKey | INFDPOAKFNIJBF-UHFFFAOYSA-N |
SMILES | C[N+]1=CC=C(C=C1)C2=CC=[N+](C=C2)C |