Paraxanthine-13C4,15N3 is a high-purity isotopically labeled compound designed for advanced pharmaceutical and biochemical research. This version of Paraxanthine, featuring carbon-13 and nitrogen-15 isotopes, is vital for studies involving caffeine metabolism, pharmacokinetics, and metabolic pathway analysis. Its stable isotope labeling ensures precise and reliable analytical results. With enhanced stability and consistency, it is suitable for various experimental setups. Ideal for metabolic research, toxicology, and drug development, Paraxanthine-13C4,15N3 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
| Catalog Number | S000935 |
| CAS Number | 1173018-79-5 |
| Molecular Formula | C313C4H8N15N3O2 |
| Purity | 95% |
| IUPAC Name | 1,7-dimethyl-3H-purine-2,6-dione |
| InChI | InChI=1S/C7H8N4O2/c1-10-3-8-5-4(10)6(12)11(2)7(13)9-5/h3H,1-2H3,(H,9,13)/i4+1,5+1,6+1,7+1,8+1,9+1,11+1 |
| InChIKey | QUNWUDVFRNGTCO-UDYOVZSYSA-N |
| SMILES | CN1C=[15N][13C]2=[13C]1[13C](=O)[15N]([13C](=O)[15NH]2)C |
| Reference | 1,7-dimethyl-3H-purine-2,6-dione |
