For research use only. Not for therapeutic Use.
Paraxanthine(Cat No.:R000597), is a naturally occurring alkaloid and a metabolite of caffeine. It is formed in the human body as caffeine is broken down and is known for its stimulant properties. Paraxanthine is believed to contribute to some of the stimulating effects of caffeine, such as increased alertness and improved cognitive function. Additionally, it may have a role in enhancing lipolysis, the process of breaking down fat for energy.
CAS Number | 611-59-6 |
Synonyms | 1,7-Dimethylxanthine; 3,7-Dihydro-1,7-dimethyl-1H-purine-2,6-dione; |
Molecular Formula | C7H8N4O2 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | room temp |
IUPAC Name | 1,7-dimethyl-3H-purine-2,6-dione |
InChI | InChI=1S/C7H8N4O2/c1-10-3-8-5-4(10)6(12)11(2)7(13)9-5/h3H,1-2H3,(H,9,13) |
InChIKey | QUNWUDVFRNGTCO-UHFFFAOYSA-N |
SMILES | CN1C=NC2=C1C(=O)N(C(=O)N2)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |