For research use only. Not for therapeutic Use.
Parbendazole-d3(Cat No.:R042262)is a deuterated form of parbendazole, a benzimidazole anthelmintic drug used primarily to treat parasitic infections in animals. The incorporation of deuterium (d3) allows for enhanced tracking in pharmacokinetic studies and metabolic profiling, making it valuable in research contexts. Parbendazole works by inhibiting microtubule formation in parasites, leading to their immobilization and death. This deuterated variant aids in understanding the drug’s absorption, distribution, metabolism, and excretion (ADME) properties, and can provide insights into the drug’s efficacy and potential interactions in various biological systems.
Catalog Number | R042262 |
CAS Number | 1613439-58-9 |
Synonyms | N-(6-Butyl-1H-benzimidazol-2-yl)carbamic Acid Methyl Ester-d3; 5-Butyl-2-(carbomethoxyamino)benzimidazole-d3; Helatac-d3; Helmatac-d3; Methyl (5-butyl-1H-benzimidazol-2-yl)carbamate-d3; Methyl 5(6)-butyl-2-benzimidazolecarbamate-d3; Methyl 5-butylben |
Molecular Formula | C13H17N3O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | trideuteriomethyl N-(6-butyl-1H-benzimidazol-2-yl)carbamate |
InChI | InChI=1S/C13H17N3O2/c1-3-4-5-9-6-7-10-11(8-9)15-12(14-10)16-13(17)18-2/h6-8H,3-5H2,1-2H3,(H2,14,15,16,17)/i2D3 |
InChIKey | YRWLZFXJFBZBEY-BMSJAHLVSA-N |
SMILES | [2H]C([2H])([2H])OC(=O)NC1=NC2=C(N1)C=C(C=C2)CCCC |