For research use only. Not for therapeutic Use.
Pargyline(Cat No.:I004069)is a monoamine oxidase inhibitor (MAOI) used primarily in the treatment of hypertension and, in some cases, depression. It works by inhibiting the enzyme monoamine oxidase (MAO), which is responsible for the breakdown of neurotransmitters like serotonin, dopamine, and norepinephrine. By blocking MAO, pargyline increases the levels of these neurotransmitters in the brain and has vasodilatory effects, which can help reduce blood pressure. However, due to potential side effects and dietary restrictions (such as avoiding tyramine-rich foods), its use has been largely replaced by newer antihypertensive medications and antidepressants.
CAS Number | 555-57-7 |
Molecular Formula | C11H13N |
Purity | ≥95% |
Target | Monoamine Oxidase |
Solubility | 10 mM in H2O |
Storage | Store at -20°C |
IUPAC Name | N-benzyl-N-methylprop-2-yn-1-amine |
InChI | InChI=1S/C11H13N/c1-3-9-12(2)10-11-7-5-4-6-8-11/h1,4-8H,9-10H2,2H3 |
InChIKey | DPWPWRLQFGFJFI-UHFFFAOYSA-N |
SMILES | CN(CC#C)CC1=CC=CC=C1 |
Reference | <p style=/line-height:25px/> |