For research use only. Not for therapeutic Use.
PARP-1-IN-2（Cat No.:I043539）is a small-molecule inhibitor that targets poly(ADP-ribose) polymerase 1 (PARP-1), an enzyme crucial for DNA repair and maintaining genomic stability. PARP-1 is involved in repairing DNA single-strand breaks through the poly ADP-ribosylation process. By inhibiting PARP-1, PARP-1-IN-2 prevents the repair of DNA damage, which can lead to cell death, particularly in cancer cells. This makes it a promising candidate for cancer therapy, particularly in tumors with defective DNA repair mechanisms. PARP-1-IN-2 is being studied to enhance the effectiveness of chemotherapy and radiation treatments.
| CAS Number | 684234-55-7 |
| Synonyms | N-(3-chlorophenyl)-2-[4-(4-chlorophenyl)-1-oxophthalazin-2-yl]acetamide |
| Molecular Formula | C22H15Cl2N3O2 |
| Purity | ≥95% |
| IUPAC Name | N-(3-chlorophenyl)-2-[4-(4-chlorophenyl)-1-oxophthalazin-2-yl]acetamide |
| InChI | InChI=1S/C22H15Cl2N3O2/c23-15-10-8-14(9-11-15)21-18-6-1-2-7-19(18)22(29)27(26-21)13-20(28)25-17-5-3-4-16(24)12-17/h1-12H,13H2,(H,25,28) |
| InChIKey | ASIIOGZHCMSESG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NN(C2=O)CC(=O)NC3=CC(=CC=C3)Cl)C4=CC=C(C=C4)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
