For research use only. Not for therapeutic Use.
PARP-1-IN-3(Cat No.:I041226)is a potent inhibitor of poly(ADP-ribose) polymerase 1 (PARP-1), an enzyme involved in DNA repair and cellular stress response. By inhibiting PARP-1, this compound prevents the repair of DNA damage, leading to the accumulation of DNA breaks and ultimately inducing cell death, particularly in cancer cells with defective DNA repair mechanisms. PARP-1-IN-3 is being explored as a potential therapeutic agent for cancer treatment, especially in cancers with BRCA mutations or other DNA repair deficiencies. It holds promise in combination therapies to enhance the effectiveness of chemotherapy and radiation treatments.
CAS Number | 2976342-33-1 |
Synonyms | 2-[[3-[(4-bromobenzoyl)amino]phenyl]methoxy]benzamide |
Molecular Formula | C21H17BrN2O3 |
Purity | ≥95% |
IUPAC Name | 2-[[3-[(4-bromobenzoyl)amino]phenyl]methoxy]benzamide |
InChI | InChI=1S/C21H17BrN2O3/c22-16-10-8-15(9-11-16)21(26)24-17-5-3-4-14(12-17)13-27-19-7-2-1-6-18(19)20(23)25/h1-12H,13H2,(H2,23,25)(H,24,26) |
InChIKey | VYGPONYCLGMRIN-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)C(=O)N)OCC2=CC(=CC=C2)NC(=O)C3=CC=C(C=C3)Br |