For research use only. Not for therapeutic Use.
PARP1-IN-11（Cat No.:I043502）is a small-molecule inhibitor targeting poly(ADP-ribose) polymerase 1 (PARP1), an enzyme involved in DNA repair, particularly in response to single-strand breaks. PARP1 plays a critical role in maintaining genomic stability and facilitating DNA repair mechanisms. By inhibiting PARP1, PARP1-IN-11 disrupts these repair processes, making it a promising candidate for cancer treatment. It sensitizes cancer cells to DNA-damaging therapies, such as chemotherapy and radiation, by preventing the repair of damaged DNA. PARP1-IN-11 is being investigated for its potential to enhance the efficacy of cancer treatments, especially in tumors with defective DNA repair.
| CAS Number | 2482484-87-5 |
| Synonyms | (2Z)-2-[(4-hydroxyphenyl)methylidene]-3-oxo-4H-1,4-benzoxazine-8-carboxamide |
| Molecular Formula | C16H12N2O4 |
| Purity | ≥95% |
| IUPAC Name | (2Z)-2-[(4-hydroxyphenyl)methylidene]-3-oxo-4H-1,4-benzoxazine-8-carboxamide |
| InChI | InChI=1S/C16H12N2O4/c17-15(20)11-2-1-3-12-14(11)22-13(16(21)18-12)8-9-4-6-10(19)7-5-9/h1-8,19H,(H2,17,20)(H,18,21)/b13-8- |
| InChIKey | JGBVVZIJHAUTTK-JYRVWZFOSA-N |
| SMILES | C1=CC(=C2C(=C1)NC(=O)/C(=C/C3=CC=C(C=C3)O)/O2)C(=O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
