For research use only. Not for therapeutic Use.
Paspalinine is a natural alkaloid found in certain species of fungi, particularly Paspalum ergot fungi. This compound exhibits diverse biological activities, including antimicrobial and insecticidal properties. Paspalinine has garnered interest in agricultural and pharmaceutical research for its potential applications in crop protection and drug discovery. Its unique chemical structure and pharmacological effects make it a subject of investigation for developing novel pesticides and pharmaceutical agents. Ongoing studies aim to elucidate its mechanisms of action and optimize its efficacy and safety profiles for potential use in agriculture and medicine.
| Catalog Number | R065946 |
| CAS Number | 63722-91-8 |
| Molecular Formula | C27H31NO4 |
| Purity | ≥95% |
| Target | Alkaloids |
| Storage | -20°C |
| InChI | InChI=1S/C27H31NO4/c1-23(2)22-19(29)14-20-26(30)10-9-15-13-17-16-7-5-6-8-18(16)28-21(17)25(15,4)24(26,3)11-12-27(20,31-22)32-23/h5-8,14-15,22,28,30H,9-13H2,1-4H3/t15-,22-,24+,25+,26+,27-/m0/s1 |
| InChIKey | BPTIXFRJAOKMRK-SAMRHTEJSA-N |
| SMILES | CC1(C2C(=O)C=C3C4(CCC5CC6=C(C5(C4(CCC3(O2)O1)C)C)NC7=CC=CC=C67)O)C |
