For research use only. Not for therapeutic Use.
PB-<wbr></wbr>22 (Item No. <span class=/itemid/>14096</span>) is a synthetic cannabinoid that is structurally analogous to the potent aminoalkylindoles like JWH 018 (Item No. <span class=/itemid/>10900</span>). It differs from JWH 018 by having 8-<wbr></wbr>hydroxyquinoline replacing the naphthalene group of JWH 018. PB-<wbr></wbr>22 5-<wbr></wbr>hydroxyquinoline isomer is a structural isomer of PB-<wbr></wbr>22. The physiological and toxicological properties of this compound have not been characterized. This product is intended for forensic and research purposes.
| Catalog Number | R064843 |
| Synonyms | quinolin-5-yl 1-pentyl-1H-indole-3-carboxylate |
| Molecular Formula | C23H22N2O2 |
| Purity | ≥95% |
| Storage | -20°C |
| InChI | InChI=1S/C23H22N2O2/c1-2-3-6-15-25-16-19(17-9-4-5-12-21(17)25)23(26)27-22-13-7-11-20-18(22)10-8-14-24-20/h4-5,7-14,16H,2-3,6,15H2,1H3 |
| InChIKey | OSRRQNMXXGSCGK-UHFFFAOYSA-N |
| SMILES | O=C(OC1=CC=CC2=C1C=CC=N2)C3=CN(CCCCC)C4=C3C=CC=C4 |
