For research use only. Not for therapeutic Use.
PBB 103（Cat No.:C001037）, also known as Polybrominated Biphenyl 103. It is a member of the polybrominated biphenyls (PBBs) family, which are a group of synthetic organic compounds containing multiple bromine atoms. PBB 103 was historically used as a flame retardant in various products, including plastics, textiles, and electrical equipment. However, due to its persistence in the environment and potential toxicity, its usage has been restricted or banned in many countries. PBB 103 can bioaccumulate in organisms and may pose health risks, including endocrine disruption and neurological effects.
| Catalog Number | C001037 |
| CAS Number | 59080-39-6 |
| Synonyms | 2,2′,4,5′,6-Pentabromo-1,1′-biphenyl; 2,2′,4,5′,6-Pentabromobiphenyl; 2,4,6,2′,5′-Pentabromobiphenyl |
| Molecular Formula | C₁₂H₅Br₅ |
| Purity | ≥95% |
| Solubility | Chloroform (Slightly), Dichloromethane (Slightly) |
| Appearance | White to Off-White Solid |
| Storage | -20°C |
| IUPAC Name | 1,3,5-tribromo-2-(2,5-dibromophenyl)benzene |
| InChI | InChI=1S/C12H5Br5/c13-6-1-2-9(15)8(3-6)12-10(16)4-7(14)5-11(12)17/h1-5H |
| InChIKey | NVKQKAZYUPPRJX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C2=C(C=C(C=C2Br)Br)Br)Br |
| Reference | Thoma, H. and Hutzinger, O. Chemosphere 16, 1353 (1987) |
