For research use only. Not for therapeutic Use.
PBD dimer-2(Cat No.:I042479)is a chemical compound that functions as a potent DNA-binding agent. It consists of two pyrrole-imidazole (PBD) units, which can bind to specific DNA sequences, inducing DNA damage and disrupting cellular processes such as replication and transcription. This dimeric structure enhances its ability to form stable complexes with DNA, leading to potential therapeutic applications in cancer treatment. PBD dimer-2 is being studied for its ability to target cancer cells, particularly those with specific genetic mutations or altered DNA repair mechanisms, by inducing cytotoxicity and preventing tumor growth.
CAS Number | 145325-57-1 |
Synonyms | (6aS)-3-[5-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]pentoxy]-2-methoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
Molecular Formula | C31H36N4O6 |
Purity | ≥95% |
IUPAC Name | (6aS)-3-[5-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]pentoxy]-2-methoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
InChI | InChI=1S/C31H36N4O6/c1-38-26-14-22-24(32-18-20-8-6-10-34(20)30(22)36)16-28(26)40-12-4-3-5-13-41-29-17-25-23(15-27(29)39-2)31(37)35-11-7-9-21(35)19-33-25/h14-21H,3-13H2,1-2H3/t20-,21-/m0/s1 |
InChIKey | JMRUKTNVBSHJFI-SFTDATJTSA-N |
SMILES | COC1=C(C=C2C(=C1)C(=O)N3CCC[C@H]3C=N2)OCCCCCOC4=C(C=C5C(=C4)N=C[C@@H]6CCCN6C5=O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |