For research use only. Not for therapeutic Use.
PBI-1393(CAT: I034271) is a potent modulator of immune responses, enhancing Th1-type cytokine production and promoting primary T cell activation. By stimulating the secretion of key cytokines such as interferon-gamma (IFN-γ) and interleukin-2 (IL-2), PBI-1393 drives Th1-dominated immune pathways, which are critical for antiviral and antitumor immunity. This compound is widely utilized in immunological research to investigate T cell activation mechanisms and the regulation of cytokine profiles. Its unique activity positions it as a valuable tool for studying immune modulation and developing therapeutic strategies for infectious diseases, cancer immunotherapy, and autoimmune disorders.
| CAS Number | 175072-12-5 |
| Synonyms | PBI-1393; PBI 1393; PBI1393; BCH-1393; BCH 1393; BCH1393; N,N-Dimethylaminopurine pentoxycarbonyl D-arginine; |
| Molecular Formula | C19H31N9O4 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | (2R)-5-(diaminomethylideneamino)-2-[5-[6-(dimethylamino)purin-9-yl]pentoxycarbonylamino]pentanoic acid |
| InChI | InChI=1S/C19H31N9O4/c1-27(2)15-14-16(24-11-23-15)28(12-25-14)9-4-3-5-10-32-19(31)26-13(17(29)30)7-6-8-22-18(20)21/h11-13H,3-10H2,1-2H3,(H,26,31)(H,29,30)(H4,20,21,22)/t13-/m1/s1 |
| InChIKey | WDXGFWJKUKJXAT-CYBMUJFWSA-N |
| SMILES | CN(C)C1=NC=NC2=C1N=CN2CCCCCOC(=O)N[C@H](CCCN=C(N)N)C(=O)O |
