For research use only. Not for therapeutic Use.
PBR28（Cat No.:I041170）is a novel peptide-based compound being developed for its potential in treating neurodegenerative diseases, particularly Alzheimer’s disease. It targets the peripheral benzodiazepine receptor (PBR), which plays a role in neuroinflammation and neuronal dysfunction. PBR28 is designed to modulate the activation of this receptor, aiming to reduce neuroinflammation and protect neurons from damage. Preclinical studies have shown that PBR28 may help improve cognitive function and slow disease progression. Ongoing research and clinical trials are evaluating its safety, efficacy, and potential therapeutic benefits for patients with neurodegenerative conditions.
| CAS Number | 253307-65-2 |
| Synonyms | N-[(2-methoxyphenyl)methyl]-N-(4-phenoxypyridin-3-yl)acetamide |
| Molecular Formula | C21H20N2O3 |
| Purity | ≥95% |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]-N-(4-phenoxypyridin-3-yl)acetamide |
| InChI | InChI=1S/C21H20N2O3/c1-16(24)23(15-17-8-6-7-11-20(17)25-2)19-14-22-13-12-21(19)26-18-9-4-3-5-10-18/h3-14H,15H2,1-2H3 |
| InChIKey | DHZBNHMEIOBPAE-UHFFFAOYSA-N |
| SMILES | CC(=O)N(CC1=CC=CC=C1OC)C2=C(C=CN=C2)OC3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
