For research use only. Not for therapeutic Use.
PCLX-001（Cat No.:I025644）is a small-molecule compound under investigation for its potential in treating inflammatory diseases and cancers. It functions as a selective inhibitor of certain kinases involved in cellular signaling pathways that regulate inflammation, cell proliferation, and survival. By targeting these pathways, PCLX-001 aims to reduce inflammation and inhibit tumor growth. The compound has shown promise in preclinical studies, particularly for conditions like rheumatoid arthritis and various cancers, where it could complement existing treatments or provide a novel therapeutic approach by modulating immune responses and cellular growth mechanisms.
| CAS Number | 1215011-08-7 |
| Synonyms | 2,6-dichloro-N-[1,5-dimethyl-3-(2-methylpropyl)pyrazol-4-yl]-4-(2-piperazin-1-ylpyridin-4-yl)benzenesulfonamide |
| Molecular Formula | C24H30Cl2N6O2S |
| Purity | ≥95% |
| IUPAC Name | 2,6-dichloro-N-[1,5-dimethyl-3-(2-methylpropyl)pyrazol-4-yl]-4-(2-piperazin-1-ylpyridin-4-yl)benzenesulfonamide |
| InChI | InChI=1S/C24H30Cl2N6O2S/c1-15(2)11-21-23(16(3)31(4)29-21)30-35(33,34)24-19(25)12-18(13-20(24)26)17-5-6-28-22(14-17)32-9-7-27-8-10-32/h5-6,12-15,27,30H,7-11H2,1-4H3 |
| InChIKey | WKTSLVQYGBHNRV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C)CC(C)C)NS(=O)(=O)C2=C(C=C(C=C2Cl)C3=CC(=NC=C3)N4CCNCC4)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
