For research use only. Not for therapeutic Use.
PD 116779 is a new antitumor antibiotic of the benz[a]anthraquinone class.
| Catalog Number | I008578 |
| CAS Number | 102674-89-5 |
| Synonyms | PD116,779; PD 116,779; PD-116,779; PD-116779; PD116779; PD 116779;2,3,8-trihydroxy-3-methyl-3,4-dihydrotetraphene-1,7,12(2H)-trione |
| Molecular Formula | C19H14O6 |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4 °C for short term, or -20 °C for long term |
| IUPAC Name | 2,3,8-trihydroxy-3-methyl-2,4-dihydrobenzo[a]anthracene-1,7,12-trione |
| InChI | InChI=1S/C19H14O6/c1-19(25)7-8-5-6-10-14(12(8)17(23)18(19)24)16(22)9-3-2-4-11(20)13(9)15(10)21/h2-6,18,20,24-25H,7H2,1H3 |
| InChIKey | ZGIMJLWQWQRQNJ-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C(=O)C1O)C3=C(C=C2)C(=O)C4=C(C3=O)C=CC=C4O)O |
| Reference | 1:J Antibiot (Tokyo). 1986 Mar;39(3):469-70. PD 116,779, a new antitumor antibiotic of the benz[a]anthraquinone class.Kern DL,Schaumberg JP,Hokanson GC,French JC, PMID: 3754549 |
