For research use only. Not for therapeutic Use.
PD146176 (Cat No.:I008607), also known as NSC168807, is a highly potent inhibitor of 15-lipoxygenase (15-LO), an enzyme involved in the biosynthesis of various lipid mediators. It exhibits a Ki value of 197 nM for rabbit reticulocyte 15-LO, indicating strong binding affinity. By inhibiting 15-LO, PD146176 can modulate the production of inflammatory lipid metabolites, offering potential therapeutic applications in diseases associated with excessive 15-LO activity, such as inflammation, asthma, and cardiovascular disorders.
| Catalog Number | I008607 |
| CAS Number | 4079-26-9 |
| Synonyms | PD 146176; PD-146176; PD146176; NSC 168807; NSC-168807; NSC168807.;6,11-dihydro-[1]benzothiopyrano[4,3-b]indole |
| Molecular Formula | C15H11NS |
| Purity | ≥95% |
| Target | 5-Lipoxygenase |
| Solubility | Soluble in DMSO |
| Storage | Store at 4 °C |
| IUPAC Name | 6,11-dihydrothiochromeno[4,3-b]indole |
| InChI | InChI=1S/C15H11NS/c1-3-7-13-10(5-1)12-9-17-14-8-4-2-6-11(14)15(12)16-13/h1-8,16H,9H2 |
| InChIKey | ZGOOPZVQMLHPFM-UHFFFAOYSA-N |
| SMILES | C1C2=C(C3=CC=CC=C3S1)NC4=CC=CC=C24 |
| Reference | </br>1:Baragatti B, Coceani F. Arachidonic acid epoxygenase and 12(S)-lipoxygenase: evidence of their concerted involvement in ductus arteriosus constriction to oxygen. Can J Physiol Pharmacol. 2011 May;89(5):329-34. doi: 10.1139/y11-025. PubMed PMID: 21619415.</br>2:Mangino MJ, Brounts L, Harms B, Heise C. Lipoxin biosynthesis in inflammatory bowel disease. Prostaglandins Other Lipid Mediat. 2006 Mar;79(1-2):84-92. PubMed PMID: 16516812. |
