PD 180970(Cat No.:R062076) is a potent small-molecule inhibitor of the Bcr-Abl tyrosine kinase, an enzyme commonly associated with chronic myeloid leukemia (CML). By targeting and inhibiting the activity of Bcr-Abl, PD 180970 disrupts the signaling pathways that promote cancer cell proliferation and survival. This compound is particularly studied for its ability to overcome resistance to other tyrosine kinase inhibitors, such as imatinib, in patients with CML. PD 180970 also shows activity against other tyrosine kinases, such as Src family kinases, making it a valuable tool in cancer research for understanding kinase-driven malignancies and developing targeted therapies.
| Catalog Number | R062076 |
| CAS Number | 287204-45-9 |
| Synonyms | 6-(2,6-Dichlorophenyl)-2-[(4-fluoro-3-methylphenyl)amino]-8-methyl-pyrido[2,3-d]pyrimidin-7(8H)-one |
| Molecular Formula | C21H15Cl2FN4O |
| Purity | ≥95% |
| Target | Bcr-Abl |
| Solubility | Soluble in DMSO > 10 mM |
| Storage | Store at +4C |
| IUPAC Name | 6-(2,6-dichlorophenyl)-2-(4-fluoro-3-methylanilino)-8-methylpyrido[2,3-d]pyrimidin-7-one |
| InChI | InChI=1S/C21H15Cl2FN4O/c1-11-8-13(6-7-17(11)24)26-21-25-10-12-9-14(20(29)28(2)19(12)27-21)18-15(22)4-3-5-16(18)23/h3-10H,1-2H3,(H,25,26,27) |
| InChIKey | SLCFEJAMCRLYRG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)NC2=NC=C3C=C(C(=O)N(C3=N2)C)C4=C(C=CC=C4Cl)Cl)F |
