For research use only. Not for therapeutic Use.
PD 404182 is a small-molecule compound known for its ability to induce DNA damage in cancer cells by interacting with DNA and disrupting the replication process. It has been primarily studied for its potential in cancer research due to its cytotoxic effects on rapidly dividing cells, leading to apoptosis. PD 404182 is also recognized for its role as a chemical tool for studying DNA repair mechanisms, as it creates DNA lesions that trigger the cellular DNA damage response. Its unique ability to interfere with DNA integrity makes it a valuable compound in cancer treatment and genomic research.
| Catalog Number | I008627 |
| CAS Number | 72596-74-8 |
| Synonyms | 3,4-dihydro-2H-pyrimido[1,2-c][1,3]benzothiazin-6-imine |
| Molecular Formula | C11H11N3S |
| Purity | ≥95% |
| InChI | InChI=1S/C11H11N3S/c12-11-14-7-3-6-13-10(14)8-4-1-2-5-9(8)15-11/h1-2,4-5,12H,3,6-7H2 |
| InChIKey | JNENSSREQFBZGT-UHFFFAOYSA-N |
| SMILES | C1CN=C2C3=CC=CC=C3SC(=N)N2C1 |
