PD0166285(Cat No.:I008570) is a potent inhibitor of Wee1 kinase and Chk1 kinase. It acts at nanomolar concentrations to inhibit the activity of these kinases, which are involved in cell cycle regulation and DNA damage response. By inhibiting Wee1 and Chk1, PD0166285 can disrupt the cell cycle progression, induce DNA damage, and potentially enhance the efficacy of DNA-damaging agents in cancer therapy. It has been studied as a potential anticancer agent, particularly in combination with chemotherapy or radiation therapy. However, further research and clinical studies are necessary to fully understand its therapeutic applications and determine its safety and efficacy in treating cancer.
| Catalog Number | I008570 |
| CAS Number | 185039-89-8 |
| Synonyms | PD166285; PD-166285; PD0166285; TCMDC-140940;6-(2,6-dichlorophenyl)-2-((4-(2-(diethylamino)ethoxy)phenyl)amino)-8-methylpyrido[2,3-d]pyrimidin-7(8H)-one |
| Molecular Formula | C26H27Cl2N5O2 |
| Purity | ≥95% |
| Target | Chk1 inhibitor |
| Solubility | Soluble in DMSO, not in water |
| Storage | 0 - 4 °C for short term, or -20 °C for long term |
| IUPAC Name | 6-(2,6-dichlorophenyl)-2-[4-[2-(diethylamino)ethoxy]anilino]-8-methylpyrido[2,3-d]pyrimidin-7-one |
| InChI | InChI=1S/C26H27Cl2N5O2/c1-4-33(5-2)13-14-35-19-11-9-18(10-12-19)30-26-29-16-17-15-20(25(34)32(3)24(17)31-26)23-21(27)7-6-8-22(23)28/h6-12,15-16H,4-5,13-14H2,1-3H3,(H,29,30,31) |
| InChIKey | IFPPYSWJNWHOLQ-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOC1=CC=C(C=C1)NC2=NC=C3C=C(C(=O)N(C3=N2)C)C4=C(C=CC=C4Cl)Cl |
| Reference | <br /> |
