For research use only. Not for therapeutic Use.
PD158780（Cat No.:I002233） is a potent, high-purity inhibitor of the epidermal growth factor receptor (EGFR) tyrosine kinase, widely used in cancer research and drug development. This compound effectively blocks EGFR signaling pathways, making it valuable for studying cell proliferation, apoptosis, and tumor growth. PD158780 is instrumental in developing targeted therapies for various cancers, including non-small cell lung cancer and breast cancer. Its precise mechanism of action and high specificity ensure reliable results in experimental setups, providing a robust tool for advancing cancer research and therapeutic innovation.
| Catalog Number | I002233 |
| CAS Number | 171179-06-9 |
| Synonyms | N4-(3-bromophenyl)-N6-methylpyrido[3,4-d]pyrimidine-4,6-diamine |
| Molecular Formula | C14H12BrN5 |
| Purity | ≥95% |
| Target | EGFR |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20C |
| IC50 | 0.08 nM [1] |
| IUPAC Name | 4-N-(3-bromophenyl)-6-N-methylpyrido[3,4-d]pyrimidine-4,6-diamine |
| InChI | InChI=1S/C14H12BrN5/c1-16-13-6-11-12(7-17-13)18-8-19-14(11)20-10-4-2-3-9(15)5-10/h2-8H,1H3,(H,16,17)(H,18,19,20) |
| InChIKey | KFHMLBXBRCITHF-UHFFFAOYSA-N |
| SMILES | CNC1=NC=C2C(=C1)C(=NC=N2)NC3=CC(=CC=C3)Br |
