For research use only. Not for therapeutic Use.
PD168393（Cat No.:I002483）is a potent and selective inhibitor of the epidermal growth factor receptor (EGFR) tyrosine kinase. This high-purity compound is crucial in advanced pharmaceutical and biochemical research, particularly in studying cancer cell signaling and therapeutic pathways. By blocking EGFR activity, PD168393 helps elucidate mechanisms of tumor growth, metastasis, and resistance to therapies. Its high specificity and reliable performance make it ideal for rigorous experimental setups, providing a robust and cost-effective solution for high-precision scientific research and the development of targeted cancer therapies.
| Catalog Number | I002483 |
| CAS Number | 194423-15-9 |
| Synonyms | N-[4-(3-bromoanilino)quinazolin-6-yl]prop-2-enamide |
| Molecular Formula | C17H13BrN4O |
| Purity | ≥95% |
| Target | Protein Tyrosine Kinase/RTK |
| Solubility | DMSO: ≥ 30 mg/mL |
| Storage | 3 years -20C powder |
| IUPAC Name | N-[4-(3-bromoanilino)quinazolin-6-yl]prop-2-enamide |
| InChI | InChI=1S/C17H13BrN4O/c1-2-16(23)21-13-6-7-15-14(9-13)17(20-10-19-15)22-12-5-3-4-11(18)8-12/h2-10H,1H2,(H,21,23)(H,19,20,22) |
| InChIKey | HTUBKQUPEREOGA-UHFFFAOYSA-N |
| SMILES | C=CC(=O)NC1=CC2=C(C=C1)N=CN=C2NC3=CC(=CC=C3)Br |
