For research use only. Not for therapeutic Use.
PDCD4-IN-1(compound 20031600) is a PDCD4 inhibitor with a Kd value of 350 nM, which can promote the expression of BDNF in hippocampal neuron cell HT-22[1].
| Catalog Number | I041163 |
| CAS Number | 494763-64-3 |
| Synonyms | 5-bromo-N’-(3-chlorophenyl)pyridine-3-carbohydrazide |
| Molecular Formula | C12H9BrClN3O |
| Purity | ≥95% |
| InChI | InChI=1S/C12H9BrClN3O/c13-9-4-8(6-15-7-9)12(18)17-16-11-3-1-2-10(14)5-11/h1-7,16H,(H,17,18) |
| InChIKey | VYRKESGWNTVDIT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)NNC(=O)C2=CC(=CN=C2)Br |
| Reference | [1]. Application of ligand small molecule of targeting PDCD4 in preparation of antidepressant drugs. CN115385914. |
