For research use only. Not for therapeutic Use.
PDE11-IN-1（Cat No.:I043471）is a selective small-molecule inhibitor targeting phosphodiesterase 11 (PDE11), an enzyme that plays a key role in regulating cyclic nucleotide signaling by breaking down cyclic AMP (cAMP) and cyclic GMP (cGMP). By inhibiting PDE11, PDE11-IN-1 increases the levels of these signaling molecules, which can affect various cellular processes such as cell growth, metabolism, and signal transduction. PDE11-IN-1 is being investigated for its therapeutic potential in conditions related to altered cyclic nucleotide signaling, including certain neurological disorders, cancer, and metabolic diseases, offering a novel approach to modulating cellular functions.
| CAS Number | 522652-41-1 |
| Synonyms | 3-(3-chlorophenyl)-8-methoxy-[1,3,5]triazino[2,1-b][1,3]benzothiazole-2,4-dione |
| Molecular Formula | C16H10ClN3O3S |
| Purity | ≥95% |
| IUPAC Name | 3-(3-chlorophenyl)-8-methoxy-[1,3,5]triazino[2,1-b][1,3]benzothiazole-2,4-dione |
| InChI | InChI=1S/C16H10ClN3O3S/c1-23-11-5-6-12-13(8-11)24-15-18-14(21)19(16(22)20(12)15)10-4-2-3-9(17)7-10/h2-8H,1H3 |
| InChIKey | WZXVKFIBUSGTCO-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N3C(=NC(=O)N(C3=O)C4=CC(=CC=C4)Cl)S2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
