For research use only. Not for therapeutic Use.
PDE4B-IN-2 (Cat No.:I015370) is a compound known as a phosphodiesterase 4B (PDE4B) inhibitor. It is designed to selectively inhibit the activity of PDE4B, an enzyme involved in the breakdown of cyclic adenosine monophosphate (cAMP). By inhibiting PDE4B, PDE4B-IN-2 increases cAMP levels, which can have various effects on cellular processes. This compound holds the potential for modulating inflammatory responses and neuronal signaling.
Catalog Number | I015370 |
CAS Number | 915082-52-9 |
Molecular Formula | C₁₉H₁₈ClN₃O₂S |
Purity | ≥95% |
Target | Phosphodiesterase (PDE) |
Storage | Store at -20°C |
IUPAC Name | 2-[4-[[2-(5-chlorothiophen-2-yl)-5-ethyl-6-methylpyrimidin-4-yl]amino]phenyl]acetic acid |
InChI | InChI=1S/C19H18ClN3O2S/c1-3-14-11(2)21-19(15-8-9-16(20)26-15)23-18(14)22-13-6-4-12(5-7-13)10-17(24)25/h4-9H,3,10H2,1-2H3,(H,24,25)(H,21,22,23) |
InChIKey | FDVSPBLZPJMXFV-UHFFFAOYSA-N |
SMILES | CCC1=C(N=C(N=C1NC2=CC=C(C=C2)CC(=O)O)C3=CC=C(S3)Cl)C |