For research use only. Not for therapeutic Use.
PDK1 inhibitors（Cat No.:I000072）are small molecules that target and block the activity of PDK1, an enzyme involved in several cellular processes such as cell survival, growth, and metabolism. PDK1 plays a critical role in activating the AKT signaling pathway, which is implicated in cancer, diabetes, and other diseases. By inhibiting PDK1, these compounds can suppress tumor growth, enhance cell death in cancer cells, and potentially improve the efficacy of other treatments. PDK1 inhibitors are being researched for their therapeutic potential in cancer therapy, metabolic disorders, and neurological conditions.
| Catalog Number | I000072 |
| CAS Number | 1001409-50-2 |
| Synonyms | 1-[(3,4-difluorophenyl)methyl]-2-oxo-N-[(1R)-2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)oxy]-1-phenylethyl]pyridine-3-carboxamide |
| Molecular Formula | C28H22F2N4O4 |
| Purity | ≥95% |
| Target | PDK-1 |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-2-oxo-N-[(1R)-2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)oxy]-1-phenylethyl]pyridine-3-carboxamide |
| InChI | InChI=1S/C28H22F2N4O4/c29-21-10-8-17(13-22(21)30)15-34-12-4-7-20(27(34)36)26(35)31-25(18-5-2-1-3-6-18)16-38-19-9-11-23-24(14-19)33-28(37)32-23/h1-14,25H,15-16H2,(H,31,35)(H2,32,33,37)/t25-/m0/s1 |
| InChIKey | GCWCGSPBENFEPE-VWLOTQADSA-N |
| SMILES | C1=CC=C(C=C1)[C@H](COC2=CC3=C(C=C2)NC(=O)N3)NC(=O)C4=CC=CN(C4=O)CC5=CC(=C(C=C5)F)F |
