For research use only. Not for therapeutic Use.
PDM-11 is a derivative of resveratrol that exhibits stronger antagonist affinity for arylhydrocarbon receptors (AhR) than resveratrol, without any affinity for the estrogen receptor.
| Catalog Number | I011435 |
| CAS Number | 1032508-03-4 |
| Molecular Formula | C16H15ClO2 |
| Purity | ≥95% |
| Storage | 3 years -20°C powder |
| SMILES | COC1=CC(=CC(=C1)C=CC2=CC=C(C=C2)Cl)OC |
| Reference | [1] Yara Rhayem, et al. Chem Phys Lipids. 2008 Sep;155(1):48-56. |
