For research use only. Not for therapeutic Use.
PDP-EA(Cat No.:I011133)is a synthetic compound used in scientific research, primarily to study cellular processes and signaling pathways. It acts as an inhibitor of certain enzymes or receptors, potentially modulating key biological functions. While its exact mechanism of action depends on the context, PDP-EA is often investigated for its effects on cell proliferation, apoptosis, or other cellular behaviors. It has shown promise in preclinical studies as a tool for cancer research, immune modulation, and drug development, contributing to the exploration of new therapeutic approaches for various diseases, particularly in oncology and inflammation.
CAS Number | 861891-72-7 |
Synonyms | N-(2-hydroxyethyl)-2-(3-pentadecylphenoxy)acetamide |
Molecular Formula | C25H43NO3 |
Purity | ≥95% |
IUPAC Name | N-(2-hydroxyethyl)-2-(3-pentadecylphenoxy)acetamide |
InChI | InChI=1S/C25H43NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-23-17-15-18-24(21-23)29-22-25(28)26-19-20-27/h15,17-18,21,27H,2-14,16,19-20,22H2,1H3,(H,26,28) |
InChIKey | BIOVSNWTCKRADD-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCCCCCC1=CC(=CC=C1)OCC(=O)NCCO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |