For research use only. Not for therapeutic Use.
PDP-Pfp is a reducible ADC linker used for the agents that target for the extracellular loop 1 (ECL1) of TM4SF1 (transmembrane 4 L6 family member 1)[1].
| Catalog Number | I017809 |
| CAS Number | 160580-70-1 |
| Synonyms | (2,3,4,5,6-pentafluorophenyl) 3-(pyridin-2-yldisulfanyl)propanoate |
| Molecular Formula | C14H8F5NO2S2 |
| Purity | ≥95% |
| InChI | InChI=1S/C14H8F5NO2S2/c15-9-10(16)12(18)14(13(19)11(9)17)22-8(21)4-6-23-24-7-3-1-2-5-20-7/h1-3,5H,4,6H2 |
| InChIKey | ICRMTRFPJXTUCG-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)SSCCC(=O)OC2=C(C(=C(C(=C2F)F)F)F)F |
| Reference | [1]. Fang J,New target for treating cancer. WO2019015696A2. |
