For research use only. Not for therapeutic Use.
pdTp (Cat No.:I034334) is the active form of vitamin B6, essential for a wide range of biological processes. It serves as a coenzyme in various enzymatic reactions, particularly in amino acid metabolism, neurotransmitter synthesis, and the production of hemoglobin. pdTp is crucial for maintaining healthy brain function, immune response, and red blood cell production. It also plays a role in the synthesis of certain enzymes involved in carbohydrate and lipid metabolism. Deficiencies in pdTp can lead to neurological and metabolic disorders, making it vital for overall health.
CAS Number | 2863-04-9 |
Synonyms | pdTp; Thymidine 3',5'-biphosphate; |
Molecular Formula | C10H16N2O11P2 |
Purity | 98% |
Target | Apoptosis |
Solubility | Soluble in DMSO |
Appearance | Solid powder |
Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
IUPAC Name | [(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate |
InChI | InChI=1S/C10H16N2O11P2/c1-5-3-12(10(14)11-9(5)13)8-2-6(23-25(18,19)20)7(22-8)4-21-24(15,16)17/h3,6-8H,2,4H2,1H3,(H,11,13,14)(H2,15,16,17)(H2,18,19,20)/t6-,7+,8+/m0/s1 |
InChIKey | CSNCBOPUCJOHLS-XLPZGREQSA-N |
SMILES | CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)COP(=O)(O)O)OP(=O)(O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |