For research use only. Not for therapeutic Use.
PE154（Cat No.:I010894）is a small-molecule compound that acts as an inhibitor of the protein kinase C (PKC) family, specifically targeting the PKC-δ isoform. By modulating PKC activity, PE154 has shown potential in regulating cellular processes such as growth, differentiation, and apoptosis, which are often dysregulated in cancer and other diseases. Research suggests that PE154 could have therapeutic applications in oncology, particularly in targeting cancers where PKC-δ plays a pivotal role in tumor progression and resistance to treatment. It is being studied for its ability to sensitize cancer cells to existing therapies.
| CAS Number | 1192750-33-6 |
| Synonyms | 2-[4-[[7-(diethylamino)-4-hydroxy-2-oxochromen-3-yl]methylideneamino]phenyl]-N’-(1,2,3,4-tetrahydroacridin-9-yl)acetohydrazide |
| Molecular Formula | C35H35N5O4 |
| Purity | ≥95% |
| IUPAC Name | 2-[4-[[7-(diethylamino)-4-hydroxy-2-oxochromen-3-yl]methylideneamino]phenyl]-N'-(1,2,3,4-tetrahydroacridin-9-yl)acetohydrazide |
| InChI | InChI=1S/C35H35N5O4/c1-3-40(4-2)24-17-18-27-31(20-24)44-35(43)28(34(27)42)21-36-23-15-13-22(14-16-23)19-32(41)38-39-33-25-9-5-7-11-29(25)37-30-12-8-6-10-26(30)33/h5,7,9,11,13-18,20-21,42H,3-4,6,8,10,12,19H2,1-2H3,(H,37,39)(H,38,41) |
| InChIKey | RSKDYQUBLFFWPM-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C(=C(C(=O)O2)C=NC3=CC=C(C=C3)CC(=O)NNC4=C5CCCCC5=NC6=CC=CC=C64)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
