For research use only. Not for therapeutic Use.
Pectolinarin is a flavonoid glycoside derived from Linaria species, particularly Linaria vulgaris. Known for its anti-inflammatory, antioxidant, and hepatoprotective properties, it is frequently studied for its potential therapeutic applications in managing oxidative stress-related conditions and liver diseases. Pectolinarin demonstrates inhibitory effects on pro-inflammatory mediators and enzymes, making it a promising candidate for research in chronic inflammation, cardiovascular health, and liver protection. Its pharmacological properties suggest potential in drug development for various diseases involving oxidative stress.
Catalog Number | R004885 |
CAS Number | 28978-02-1 |
Molecular Formula | C29H34O15 |
Purity | ≥95% |
Target | GPCR/G Protein |
IUPAC Name | 5-hydroxy-6-methoxy-2-(4-methoxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one |
InChI | InChI=1S/C29H34O15/c1-11-20(31)23(34)25(36)28(41-11)40-10-18-21(32)24(35)26(37)29(44-18)43-17-9-16-19(22(33)27(17)39-3)14(30)8-15(42-16)12-4-6-13(38-2)7-5-12/h4-9,11,18,20-21,23-26,28-29,31-37H,10H2,1-3H3/t11-,18+,20-,21+,23+,24-,25+,26+,28+,29+/m0/s1 |
InChIKey | PRVAKFUXKKVCCY-YLHHYQKRSA-N |
SMILES | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(C(=C4C(=C3)OC(=CC4=O)C5=CC=C(C=C5)OC)O)OC)O)O)O)O)O)O |