For research use only. Not for therapeutic Use.
Pedalitin is a flavonoid compound found in various plant sources, including the root bark of the Chinese skullcap (Scutellaria baicalensis). This bioactive molecule exhibits antioxidant and anti-inflammatory properties, making it of interest in herbal medicine and natural product research. Pedalitin has been studied for its potential therapeutic effects, including neuroprotective and anticancer activities. Research suggests that pedalitin may modulate cellular pathways involved in inflammation and oxidative stress. Its presence in medicinal plants underscores its potential as a functional compound with applications in traditional and modern medicine. Ongoing studies aim to elucidate its mechanisms and pharmacological effects.
| Catalog Number | R064422 |
| CAS Number | 22384-63-0 |
| Molecular Formula | C16H12O7 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | Store at -20°C |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5,6-dihydroxy-7-methoxychromen-4-one |
| InChI | InChI=1S/C16H12O7/c1-22-13-6-12-14(16(21)15(13)20)10(19)5-11(23-12)7-2-3-8(17)9(18)4-7/h2-6,17-18,20-21H,1H3 |
| InChIKey | QWUHUBDKQQPMQG-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C2C(=C1)OC(=CC2=O)C3=CC(=C(C=C3)O)O)O)O |
