For research use only. Not for therapeutic Use.
Pefloxacin-d3 is a high-purity deuterated compound crucial for advanced pharmaceutical research. This isotopically labeled version of Pefloxacin contains three deuterium atoms, making it essential for studies on antibacterial activity, fluoroquinolone mechanisms, and drug metabolism. Its stable isotope labeling ensures precise and reliable analytical results, enhancing the accuracy of pharmacokinetic and pharmacodynamic studies. With improved stability and consistency, Pefloxacin-d3 integrates seamlessly into various experimental protocols, offering a robust and cost-effective solution for high-precision scientific investigations. Ideal for research and development, it supports the advancement of safer and more effective therapeutic agents.
| Catalog Number | S001102 |
| CAS Number | 2733455-58-6 |
| Molecular Formula | C17H17D3FN3O3 |
| Purity | ≥95% |
| IUPAC Name | 1-ethyl-6-fluoro-4-oxo-7-[4-(trideuteriomethyl)piperazin-1-yl]quinoline-3-carboxylic acid |
| InChI | InChI=1S/C17H20FN3O3/c1-3-20-10-12(17(23)24)16(22)11-8-13(18)15(9-14(11)20)21-6-4-19(2)5-7-21/h8-10H,3-7H2,1-2H3,(H,23,24)/i2D3 |
| InChIKey | FHFYDNQZQSQIAI-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])N1CCN(CC1)C2=C(C=C3C(=C2)N(C=C(C3=O)C(=O)O)CC)F |
