For research use only. Not for therapeutic Use.
Pefloxacin-d5(Cat No.:S000462) is a deuterated version of pefloxacin, where five hydrogen atoms are replaced with deuterium, enhancing its stability for detailed pharmacokinetic studies. Pefloxacin is a fluoroquinolone antibiotic used to treat various bacterial infections by inhibiting bacterial DNA gyrase, an enzyme critical for DNA replication. The deuterated version, Pefloxacin-d5, is particularly useful in research to investigate how the substitution of deuterium affects the drug’s absorption, distribution, metabolism, and excretion. This information is crucial for understanding the drug’s efficacy, potential side effects, and interactions with other medications.
CAS Number | 1228182-51-1 |
Molecular Formula | C17H15D5FN3O3 |
Purity | ≥95% |
Target | Bacterial |
IUPAC Name | 6-fluoro-7-(4-methylpiperazin-1-yl)-4-oxo-1-(1,1,2,2,2-pentadeuterioethyl)quinoline-3-carboxylic acid |
InChI | InChI=1S/C17H20FN3O3/c1-3-20-10-12(17(23)24)16(22)11-8-13(18)15(9-14(11)20)21-6-4-19(2)5-7-21/h8-10H,3-7H2,1-2H3,(H,23,24)/i1D3,3D2 |
InChIKey | FHFYDNQZQSQIAI-WNWXXORZSA-N |
SMILES | CCN1C=C(C(=O)C2=CC(=C(C=C21)N3CCN(CC3)C)F)C(=O)O |