For research use only. Not for therapeutic Use.
Pefloxacin(Cat No.:I004644) is a synthetic broad-spectrum fluoroquinolone antibiotic used to treat bacterial infections. It inhibits bacterial DNA gyrase and topoisomerase IV, enzymes essential for DNA replication and transcription, leading to the death of the bacteria. Pefloxacin is effective against a wide range of Gram-negative and some Gram-positive bacteria, making it useful in treating respiratory, urinary tract, gastrointestinal, and skin infections. It is particularly valued for its tissue penetration, especially in the treatment of intracellular bacterial infections. However, like other fluoroquinolones, it carries a risk of side effects, including tendonitis and potential neurotoxicity, which limits its use in certain patient populations.
| Catalog Number | I004644 |
| CAS Number | 70458-92-3 |
| Synonyms | 1-ethyl-6-fluoro-7-(4-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid |
| Molecular Formula | C17H20FN3O3 |
| Purity | ≥95% |
| Target | Antibiotic |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20C |
| IUPAC Name | 1-ethyl-6-fluoro-7-(4-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid |
| InChI | InChI=1S/C17H20FN3O3/c1-3-20-10-12(17(23)24)16(22)11-8-13(18)15(9-14(11)20)21-6-4-19(2)5-7-21/h8-10H,3-7H2,1-2H3,(H,23,24) |
| InChIKey | FHFYDNQZQSQIAI-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=O)C2=CC(=C(C=C21)N3CCN(CC3)C)F)C(=O)O |
