For research use only. Not for therapeutic Use.
PEG 200 Stearate (Cat No.:R071318) is a polyethylene glycol derivative of stearic acid. It functions as an emulsifier, surfactant, and thickener in cosmetics, pharmaceuticals, and personal care products. This compound stabilizes and blends oil and water components in formulations, improving texture and spreadability. It is commonly used in creams, lotions, and ointments.
| Catalog Number | R071318 |
| CAS Number | 9004-99-3 |
| Synonyms | Protamate DPS(TM), PEG-4 Stearate(TM) |
| Molecular Formula | C20H40O3 |
| Purity | ≥95% |
| Storage | 2-8°C |
| IUPAC Name | 2-hydroxyethyl octadecanoate |
| InChI | InChI=1S/C20H40O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(22)23-19-18-21/h21H,2-19H2,1H3 |
| InChIKey | RFVNOJDQRGSOEL-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OCCO |
