For research use only. Not for therapeutic Use.
Peiminine (Cat.No:I002349) is a natural compound found in the Chinese medicinal plant Fritillaria thunbergii. It possesses various pharmacological properties, including anti-inflammatory, anticancer, and neuroprotective effects. Peiminine has shown potential in inhibiting tumor growth, reducing inflammation, and protecting against neurodegenerative diseases. Further research is ongoing to explore its therapeutic applications.
| Catalog Number | I002349 |
| CAS Number | 18059-10-4 |
| Molecular Formula | C27H43NO3 |
| Purity | ≥95% |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20℃ |
| IUPAC Name | (1R,2S,6S,9S,10S,11S,14S,15S,18S,20S,23R,24S)-10,20-dihydroxy-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosan-17-one |
| InChI | InChI=1S/C27H43NO3/c1-15-4-7-25-27(3,31)21-6-5-17-18(20(21)14-28(25)13-15)11-22-19(17)12-24(30)23-10-16(29)8-9-26(22,23)2/h15-23,25,29,31H,4-14H2,1-3H3/t15-,16-,17+,18+,19-,20-,21-,22-,23+,25-,26+,27-/m0/s1 |
| InChIKey | IQDIERHFZVCNRZ-YUYPDVIUSA-N |
| SMILES | CC1CCC2C(C3CCC4C(C3CN2C1)CC5C4CC(=O)C6C5(CCC(C6)O)C)(C)O |
| Reference | <p style=/line-height:25px/> |
