For research use only. Not for therapeutic Use.
Pelargonidin is a natural polyphenolic anthocyanidin that gives rise to red pelargonidin glycosides in plant petals and other parts. Like other polyphenolics, pelargonidin has significant antioxidant activity.
| Catalog Number | R011666 |
| CAS Number | 134-04-3 |
| Synonyms | 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)-1-benzopyrylium Chloride; 3,4’,5,7-Tetrahydroxyflavylium Chloride; Pelargonidin Chloride; Pelargonidol Chloride; |
| Molecular Formula | C15H11ClO5 |
| Purity | ≥95% |
| Target | NF-κB |
| Storage | -20°C |
| IUPAC Name | 2-(4-hydroxyphenyl)chromenylium-3,5,7-triol;chloride |
| InChI | InChI=1S/C15H10O5.ClH/c16-9-3-1-8(2-4-9)15-13(19)7-11-12(18)5-10(17)6-14(11)20-15;/h1-7H,(H3-,16,17,18,19);1H |
| InChIKey | YPVZJXMTXCOTJN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=C3C(=CC(=CC3=[O+]2)O)O)O)O.[Cl-] |
