For research use only. Not for therapeutic Use.
Pelecopan（Cat No.:I043393）is an experimental small-molecule drug under investigation for its potential to treat autoimmune and inflammatory diseases. It acts as an inhibitor of the chemoattractant receptor-homologous molecule expressed on Th2 cells (CRTH2), a receptor involved in the regulation of inflammation and immune cell recruitment. By blocking CRTH2, Pelecopan aims to reduce the inflammatory response, particularly in conditions such as asthma, allergic rhinitis, and other Th2-driven diseases. Preclinical and clinical trials are exploring its effectiveness in alleviating symptoms and improving disease outcomes by targeting specific immune pathways involved in chronic inflammation.
| CAS Number | 2378380-49-3 |
| Synonyms | 2-[2-[[7-[2-(aminomethyl)-3-fluoropyridin-4-yl]-1-benzofuran-5-yl]methoxy]phenyl]acetic acid |
| Molecular Formula | C23H19FN2O4 |
| Purity | ≥95% |
| IUPAC Name | 2-[2-[[7-[2-(aminomethyl)-3-fluoropyridin-4-yl]-1-benzofuran-5-yl]methoxy]phenyl]acetic acid |
| InChI | InChI=1S/C23H19FN2O4/c24-22-17(5-7-26-19(22)12-25)18-10-14(9-16-6-8-29-23(16)18)13-30-20-4-2-1-3-15(20)11-21(27)28/h1-10H,11-13,25H2,(H,27,28) |
| InChIKey | AUARNXJEAZFQCQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)O)OCC2=CC(=C3C(=C2)C=CO3)C4=C(C(=NC=C4)CN)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
