For research use only. Not for therapeutic Use.
Pemetrexed(Cat No.:A000773)is a multi-targeted antifolate chemotherapy drug used to treat various cancers, including non-small cell lung cancer (NSCLC) and malignant pleural mesothelioma. It works by inhibiting key enzymes involved in folate metabolism and DNA synthesis, such as thymidylate synthase and dihydrofolate reductase (DHFR). This disruption impairs the ability of cancer cells to replicate and grow. Pemetrexed is often used in combination with other chemotherapy agents to enhance its efficacy, and its ability to target multiple pathways makes it a valuable option in cancer treatment protocols.
CAS Number | 150399-23-8 |
Synonyms | LY-231514 |
Molecular Formula | C20H19N5Na2O6 |
Purity | ≥95% |
Target | Autophagy |
Solubility | >15mg/mL in DMSO |
Storage | 3 years -20C powder |
IUPAC Name | disodium;(2S)-2-[[4-[2-(2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl)ethyl]benzoyl]amino]pentanedioate |
InChI | InChI=1S/C20H21N5O6.2Na/c21-20-24-16-15(18(29)25-20)12(9-22-16)6-3-10-1-4-11(5-2-10)17(28)23-13(19(30)31)7-8-14(26)27;;/h1-2,4-5,9,13H,3,6-8H2,(H,23,28)(H,26,27)(H,30,31)(H4,21,22,24,25,29);;/q;2*+1/p-2/t13-;;/m0../s1 |
InChIKey | NYDXNILOWQXUOF-GXKRWWSZSA-L |
SMILES | C1=CC(=CC=C1CCC2=CNC3=C2C(=O)NC(=N3)N)C(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-].[Na+].[Na+] |