For research use only. Not for therapeutic Use.
Penconazole-d7(Cat No.: C000304) is a deuterated derivative of Penconazole. This compound is used in analytical chemistry and research as an isotopically labeled standard for the precise quantification and identification of Penconazole in various analytical techniques such as nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry. Deuterium substitution in specific positions (d7) of Penconazole allows for accurate and reliable analysis by reducing interference from other compounds and providing reference peaks.
CAS Number | 1628110-84-8 |
Synonyms | (±)-Penconazole-d7; CGA 71818-d7; Ofir-d7; Omnex-d7; Topas-d7 |
Molecular Formula | C₁₃H₈D₇Cl₂N₃ |
Purity | ≥95% |
Target | Neuronal Signaling |
Solubility | Chloroform (Slightly), Methanol (Slightly) |
Appearance | White to Off-White Solid |
Storage | -20°C |
IUPAC Name | 1-[3,3,4,4,5,5,5-heptadeuterio-2-(2,4-dichlorophenyl)pentyl]-1,2,4-triazole |
InChI | InChI=1S/C13H15Cl2N3/c1-2-3-10(7-18-9-16-8-17-18)12-5-4-11(14)6-13(12)15/h4-6,8-10H,2-3,7H2,1H3/i1D3,2D2,3D2 |
InChIKey | WKBPZYKAUNRMKP-NCKGIQLSSA-N |
SMILES | CCCC(CN1C=NC=N1)C2=C(C=C(C=C2)Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |