For research use only. Not for therapeutic Use.
Penconazole(Cat No.:R016939) is a synthetic fungicide belonging to the triazole group. Its mode of action involves being a systemic fungicide effective against a wide range of fungal diseases in crops. Penconazole works by inhibiting the biosynthesis of ergosterol, an essential component of fungal cell membranes. By disrupting the cell membrane, Penconazole interferes with the growth and development of fungi, preventing them from causing disease in plants. This fungicidal action makes Penconazole a valuable tool for the control of fungal pathogens in various crops, including cereals, fruits, and vegetables.
| Catalog Number | R016939 |
| CAS Number | 66246-88-6 |
| Synonyms | (±)-Penconazole; CGA 71818; Ofir; Omnex; Omnex WP 10; Pine gel; Regal gel; Topas; Topas (fungicide); Topaze |
| Molecular Formula | C13H15Cl2N3 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Storage | Store at +4C |
| IUPAC Name | 1-[2-(2,4-dichlorophenyl)pentyl]-1,2,4-triazole |
| InChI | InChI=1S/C13H15Cl2N3/c1-2-3-10(7-18-9-16-8-17-18)12-5-4-11(14)6-13(12)15/h4-6,8-10H,2-3,7H2,1H3 |
| InChIKey | WKBPZYKAUNRMKP-UHFFFAOYSA-N |
| SMILES | CCCC(CN1C=NC=N1)C2=C(C=C(C=C2)Cl)Cl |
