For research use only. Not for therapeutic Use.
Penicillin F(Cat No.:M070877) is a derivative of penicillin, a group of antibiotics used to treat bacterial infections. It possesses a broader spectrum of activity compared to other penicillins, targeting a wider range of bacteria, including some resistant strains. Penicillin F works by inhibiting the synthesis of bacterial cell walls, leading to their destruction. Its effectiveness against various pathogens makes it a valuable tool in combating infections.
CAS Number | 118-53-6 |
Molecular Formula | C14H20N2O4S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2S,5R,6R)-6-[[(E)-hex-3-enoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
InChI | InChI=1S/C14H20N2O4S/c1-4-5-6-7-8(17)15-9-11(18)16-10(13(19)20)14(2,3)21-12(9)16/h5-6,9-10,12H,4,7H2,1-3H3,(H,15,17)(H,19,20)/b6-5+/t9-,10+,12-/m1/s1 |
InChIKey | QRLCJUNAKLMRGP-ZTWGYATJSA-N |
SMILES | CCC=CCC(=O)NC1C2N(C1=O)C(C(S2)(C)C)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |